About N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide
N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 3216907) has the molecular formula C25H21ClFN3O
and a molecular weight of 433.91 g/mol. Its IUPAC name is N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide.
Molecular Properties
| Compound Name | N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide |
| PubChem CID | 3216907 |
| Molecular Formula | C25H21ClFN3O |
| Molecular Weight | 433.91 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | Cc1cc(C)c2cc(CN(Cc3cccnc3)C(=O)c3ccc(F)cc3)c(Cl)nc2c1 |
| InChI | InChI=1S/C25H21ClFN3O/c1-16-10-17(2)22-12-20(24(26)29-23(22)11-16)15-30(14-18-4-3-9-28-13-18)25(31)19-5-7-21(27)8-6-19/h3-13H,14-15H2,1-2H3 |
| InChIKey | BJBBWOZIFTXFML-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.91 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide?
The IUPAC name of N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide (CID 3216907) is N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide.
What is the SMILES notation for N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide?
The canonical SMILES for N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide is Cc1cc(C)c2cc(CN(Cc3cccnc3)C(=O)c3ccc(F)cc3)c(Cl)nc2c1.
What is the InChIKey of N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide?
The InChIKey is BJBBWOZIFTXFML-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21ClFN3O/c1-16-10-17(2)22-12-20(24(26)29-23(22)11-16)15-30(14-18-4-3-9-28-13-18)25(31)19-5-7-21(27)8-6-19/h3-13H,14-15H2,1-2H3.
What are the key properties of N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide?
N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide has a molecular weight of 433.91 g/mol, XLogP of 5.88, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-5,7-dimethylquinolin-3-yl)methyl]-4-fluoro-N-(pyridin-3-ylmethyl)benzamide is sourced from PubChem (CID 3216907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).