About 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea
1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea (PubChem CID 3216929) has the molecular formula C22H24ClN3O2
and a molecular weight of 397.91 g/mol. Its IUPAC name is 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea.
Molecular Properties
| Compound Name | 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea |
| PubChem CID | 3216929 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea |
| SMILES | COCCN(Cc1cc2cc(C)cc(C)c2nc1Cl)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H24ClN3O2/c1-15-11-16(2)20-17(12-15)13-18(21(23)25-20)14-26(9-10-28-3)22(27)24-19-7-5-4-6-8-19/h4-8,11-13H,9-10,14H2,1-3H3,(H,24,27) |
| InChIKey | MDMDOFQJYGQPMX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea?
The IUPAC name of 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea (CID 3216929) is 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea.
What is the SMILES notation for 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea?
The canonical SMILES for 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea is COCCN(Cc1cc2cc(C)cc(C)c2nc1Cl)C(=O)Nc1ccccc1.
What is the InChIKey of 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea?
The InChIKey is MDMDOFQJYGQPMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24ClN3O2/c1-15-11-16(2)20-17(12-15)13-18(21(23)25-20)14-26(9-10-28-3)22(27)24-19-7-5-4-6-8-19/h4-8,11-13H,9-10,14H2,1-3H3,(H,24,27).
What are the key properties of 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea?
1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea has a molecular weight of 397.91 g/mol, XLogP of 5.19, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-(2-methoxyethyl)-3-phenylurea is sourced from PubChem (CID 3216929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).