C15H17N5O2S — CID 3217162
N'-[2-[(5-cyclopropyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 3217162) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is N'-[2-[(5-cyclopropyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[(5-cyclopropyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 3217162 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N'-[2-[(5-cyclopropyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | Cn1c(SCC(=O)NNC(=O)c2ccccc2)nnc1C1CC1 |
| InChI | InChI=1S/C15H17N5O2S/c1-20-13(10-7-8-10)17-19-15(20)23-9-12(21)16-18-14(22)11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,16,21)(H,18,22) |
| InChIKey | IEDZMLYYCARPTA-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|