C24H20N2O4S — CID 3217526
methyl 4,6-dioxo-3,5-diphenyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 3217526) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is methyl 4,6-dioxo-3,5-diphenyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl 4,6-dioxo-3,5-diphenyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 3217526 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | methyl 4,6-dioxo-3,5-diphenyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)C1(c2ccccc2)NC(c2cccs2)C2C(=O)N(c3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C24H20N2O4S/c1-30-23(29)24(15-9-4-2-5-10-15)19-18(20(25-24)17-13-8-14-31-17)21(27)26(22(19)28)16-11-6-3-7-12-16/h2-14,18-20,25H,1H3 |
| InChIKey | QBTIXQCPRPBTAH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|