About N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide
N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide (PubChem CID 3218740) has the molecular formula C18H25N3OS
and a molecular weight of 331.49 g/mol. Its IUPAC name is N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide |
| PubChem CID | 3218740 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide |
| SMILES | Cc1cc(C)cc(NC(=S)N2CCC(NC(=O)C3CC3)CC2)c1 |
| InChI | InChI=1S/C18H25N3OS/c1-12-9-13(2)11-16(10-12)20-18(23)21-7-5-15(6-8-21)19-17(22)14-3-4-14/h9-11,14-15H,3-8H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | QPANZANXHHFZQF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide?
The IUPAC name of N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide (CID 3218740) is N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide.
What is the SMILES notation for N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide?
The canonical SMILES for N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide is Cc1cc(C)cc(NC(=S)N2CCC(NC(=O)C3CC3)CC2)c1.
What is the InChIKey of N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide?
The InChIKey is QPANZANXHHFZQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3OS/c1-12-9-13(2)11-16(10-12)20-18(23)21-7-5-15(6-8-21)19-17(22)14-3-4-14/h9-11,14-15H,3-8H2,1-2H3,(H,19,22)(H,20,23).
What are the key properties of N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide?
N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide has a molecular weight of 331.49 g/mol, XLogP of 2.99, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[(3,5-dimethylphenyl)carbamothioyl]piperidin-4-yl]cyclopropanecarboxamide is sourced from PubChem (CID 3218740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).