C26H26N6OS2 — CID 3218872
2-[(7-benzyl-11,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 3218872) has the molecular formula C26H26N6OS2 and a molecular weight of 502.67 g/mol. Its IUPAC name is 2-[(7-benzyl-11,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[(7-benzyl-11,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 3218872 |
| Molecular Formula | C26H26N6OS2 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-[(7-benzyl-11,12-dimethyl-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl)sulfanyl]-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | Cc1sc2nc(Cc3ccccc3)n3c(SCC(=O)Nc4ccc(N(C)C)cc4)nnc3c2c1C |
| InChI | InChI=1S/C26H26N6OS2/c1-16-17(2)35-25-23(16)24-29-30-26(32(24)21(28-25)14-18-8-6-5-7-9-18)34-15-22(33)27-19-10-12-20(13-11-19)31(3)4/h5-13H,14-15H2,1-4H3,(H,27,33) |
| InChIKey | FJEHIHFQYDWQHK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|