C24H24Cl2N2O3S — CID 3218985
[6'-chloro-4'-(2-chlorophenyl)-4,4-dimethyl-2-sulfanylidenespiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-7'-yl] cyclopropanecarboxylate (PubChem CID 3218985) has the molecular formula C24H24Cl2N2O3S and a molecular weight of 491.44 g/mol. Its IUPAC name is [6'-chloro-4'-(2-chlorophenyl)-4,4-dimethyl-2-sulfanylidenespiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-7'-yl] cyclopropanecarboxylate.
| Compound Name | [6'-chloro-4'-(2-chlorophenyl)-4,4-dimethyl-2-sulfanylidenespiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-7'-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 3218985 |
| Molecular Formula | C24H24Cl2N2O3S |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | [6'-chloro-4'-(2-chlorophenyl)-4,4-dimethyl-2-sulfanylidenespiro[1,3-diazinane-6,2'-3,4-dihydrochromene]-7'-yl] cyclopropanecarboxylate |
| SMILES | CC1(C)CC2(CC(c3ccccc3Cl)c3cc(Cl)c(OC(=O)C4CC4)cc3O2)NC(=S)N1 |
| InChI | InChI=1S/C24H24Cl2N2O3S/c1-23(2)12-24(28-22(32)27-23)11-16(14-5-3-4-6-17(14)25)15-9-18(26)20(10-19(15)31-24)30-21(29)13-7-8-13/h3-6,9-10,13,16H,7-8,11-12H2,1-2H3,(H2,27,28,32) |
| InChIKey | BRCMTJVECMCAKS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|