C20H23N3O4 — CID 3219712
1-N-(2-methoxyphenyl)-2-N-(3-methoxyphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 3219712) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-N-(2-methoxyphenyl)-2-N-(3-methoxyphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 1-N-(2-methoxyphenyl)-2-N-(3-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 3219712 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-N-(2-methoxyphenyl)-2-N-(3-methoxyphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | COc1cccc(NC(=O)C2CCCN2C(=O)Nc2ccccc2OC)c1 |
| InChI | InChI=1S/C20H23N3O4/c1-26-15-8-5-7-14(13-15)21-19(24)17-10-6-12-23(17)20(25)22-16-9-3-4-11-18(16)27-2/h3-5,7-9,11,13,17H,6,10,12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | LAWHYWSJUDCFIL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |