About 2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide
2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide (PubChem CID 3219765) has the molecular formula C17H19N3O3
and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide |
| PubChem CID | 3219765 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide |
| SMILES | O=C(NCc1ccco1)C1CCCN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H19N3O3/c21-16(18-12-14-8-5-11-23-14)15-9-4-10-20(15)17(22)19-13-6-2-1-3-7-13/h1-3,5-8,11,15H,4,9-10,12H2,(H,18,21)(H,19,22) |
| InChIKey | RGIHTZFEDMYHIH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide?
The IUPAC name of 2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide (CID 3219765) is 2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide.
What is the SMILES notation for 2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide?
The canonical SMILES for 2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide is O=C(NCc1ccco1)C1CCCN1C(=O)Nc1ccccc1.
What is the InChIKey of 2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide?
The InChIKey is RGIHTZFEDMYHIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3/c21-16(18-12-14-8-5-11-23-14)15-9-4-10-20(15)17(22)19-13-6-2-1-3-7-13/h1-3,5-8,11,15H,4,9-10,12H2,(H,18,21)(H,19,22).
What are the key properties of 2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide?
2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide has a molecular weight of 313.36 g/mol, XLogP of 2.59, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(furan-2-ylmethyl)-1-N-phenylpyrrolidine-1,2-dicarboxamide is sourced from PubChem (CID 3219765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).