C24H34FN3O4 — CID 3219971
N'-cyclohexyl-N-cyclopentyl-N'-[1-(2-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]oxamide (PubChem CID 3219971) has the molecular formula C24H34FN3O4 and a molecular weight of 447.55 g/mol. Its IUPAC name is N'-cyclohexyl-N-cyclopentyl-N'-[1-(2-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]oxamide.
| Compound Name | N'-cyclohexyl-N-cyclopentyl-N'-[1-(2-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]oxamide |
|---|---|
| PubChem CID | 3219971 |
| Molecular Formula | C24H34FN3O4 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | N'-cyclohexyl-N-cyclopentyl-N'-[1-(2-fluorophenyl)-2-(2-methoxyethylamino)-2-oxoethyl]oxamide |
| SMILES | COCCNC(=O)C(c1ccccc1F)N(C(=O)C(=O)NC1CCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H34FN3O4/c1-32-16-15-26-22(29)21(19-13-7-8-14-20(19)25)28(18-11-3-2-4-12-18)24(31)23(30)27-17-9-5-6-10-17/h7-8,13-14,17-18,21H,2-6,9-12,15-16H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | NOALBDAZZSVZKD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|