C29H31N3O4 — CID 3220048
N'-[2-(cyclopentylamino)-1-(furan-2-yl)-2-oxoethyl]-N-phenyl-N'-(1,2,3,4-tetrahydronaphthalen-1-yl)oxamide (PubChem CID 3220048) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is N'-[2-(cyclopentylamino)-1-(furan-2-yl)-2-oxoethyl]-N-phenyl-N'-(1,2,3,4-tetrahydronaphthalen-1-yl)oxamide.
| Compound Name | N'-[2-(cyclopentylamino)-1-(furan-2-yl)-2-oxoethyl]-N-phenyl-N'-(1,2,3,4-tetrahydronaphthalen-1-yl)oxamide |
|---|---|
| PubChem CID | 3220048 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N'-[2-(cyclopentylamino)-1-(furan-2-yl)-2-oxoethyl]-N-phenyl-N'-(1,2,3,4-tetrahydronaphthalen-1-yl)oxamide |
| SMILES | O=C(Nc1ccccc1)C(=O)N(C1CCCc2ccccc21)C(C(=O)NC1CCCC1)c1ccco1 |
| InChI | InChI=1S/C29H31N3O4/c33-27(30-21-14-5-6-15-21)26(25-18-9-19-36-25)32(24-17-8-11-20-10-4-7-16-23(20)24)29(35)28(34)31-22-12-2-1-3-13-22/h1-4,7,9-10,12-13,16,18-19,21,24,26H,5-6,8,11,14-15,17H2,(H,30,33)(H,31,34) |
| InChIKey | JRAJZONAOBUDQO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|