C26H28N4O4 — CID 3220063
N'-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-N-(2-methoxyphenyl)-N'-pyridin-3-yloxamide (PubChem CID 3220063) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is N'-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-N-(2-methoxyphenyl)-N'-pyridin-3-yloxamide.
| Compound Name | N'-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-N-(2-methoxyphenyl)-N'-pyridin-3-yloxamide |
|---|---|
| PubChem CID | 3220063 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | N'-[2-(tert-butylamino)-2-oxo-1-phenylethyl]-N-(2-methoxyphenyl)-N'-pyridin-3-yloxamide |
| SMILES | COc1ccccc1NC(=O)C(=O)N(c1cccnc1)C(C(=O)NC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H28N4O4/c1-26(2,3)29-23(31)22(18-11-6-5-7-12-18)30(19-13-10-16-27-17-19)25(33)24(32)28-20-14-8-9-15-21(20)34-4/h5-17,22H,1-4H3,(H,28,32)(H,29,31) |
| InChIKey | RBSDCPTYLMRWBB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|