C26H41N3O5 — CID 3220155
2-N-tert-butyl-3-(3-ethoxypropyl)-6-N-(2-methylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 3220155) has the molecular formula C26H41N3O5 and a molecular weight of 475.63 g/mol. Its IUPAC name is 2-N-tert-butyl-3-(3-ethoxypropyl)-6-N-(2-methylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | 2-N-tert-butyl-3-(3-ethoxypropyl)-6-N-(2-methylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 3220155 |
| Molecular Formula | C26H41N3O5 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.30 |
| IUPAC Name | 2-N-tert-butyl-3-(3-ethoxypropyl)-6-N-(2-methylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCOCCCN1C(=O)C2C(C(=O)NC3CCCCC3C)C3C=CC2(O3)C1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C26H41N3O5/c1-6-33-15-9-14-29-21(23(31)28-25(3,4)5)26-13-12-18(34-26)19(20(26)24(29)32)22(30)27-17-11-8-7-10-16(17)2/h12-13,16-21H,6-11,14-15H2,1-5H3,(H,27,30)(H,28,31) |
| InChIKey | DBYRJUVDNRHPKZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|