C17H20N4O2S2 — CID 3220444
2-methyl-N-[5-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 3220444) has the molecular formula C17H20N4O2S2 and a molecular weight of 376.51 g/mol. Its IUPAC name is 2-methyl-N-[5-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 2-methyl-N-[5-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 3220444 |
| Molecular Formula | C17H20N4O2S2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-methyl-N-[5-[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CC(C)C(=O)Nc1nnc(SCC(=O)N2c3ccccc3CC2C)s1 |
| InChI | InChI=1S/C17H20N4O2S2/c1-10(2)15(23)18-16-19-20-17(25-16)24-9-14(22)21-11(3)8-12-6-4-5-7-13(12)21/h4-7,10-11H,8-9H2,1-3H3,(H,18,19,23) |
| InChIKey | PIDLWUVMRWSOLO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|