C23H25N5O3S2 — CID 3220468
N-[5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylbenzamide (PubChem CID 3220468) has the molecular formula C23H25N5O3S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is N-[5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylbenzamide.
| Compound Name | N-[5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 3220468 |
| Molecular Formula | C23H25N5O3S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | N-[5-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylbenzamide |
| SMILES | COc1ccccc1N1CCN(C(=O)CSc2nnc(NC(=O)c3ccccc3C)s2)CC1 |
| InChI | InChI=1S/C23H25N5O3S2/c1-16-7-3-4-8-17(16)21(30)24-22-25-26-23(33-22)32-15-20(29)28-13-11-27(12-14-28)18-9-5-6-10-19(18)31-2/h3-10H,11-15H2,1-2H3,(H,24,25,30) |
| InChIKey | BIMXMRQMULCOBI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|