About N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide
N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide (PubChem CID 3220617) has the molecular formula C18H13FN2O2
and a molecular weight of 308.31 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide.
Molecular Properties
| Compound Name | N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide |
| PubChem CID | 3220617 |
| Molecular Formula | C18H13FN2O2 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide |
| SMILES | O=C(Nc1ccccc1F)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C18H13FN2O2/c19-14-9-3-4-10-16(14)21-18(23)17(22)20-15-11-5-7-12-6-1-2-8-13(12)15/h1-11H,(H,20,22)(H,21,23) |
| InChIKey | FMGBITCJNHTOCR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide?
The IUPAC name of N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide (CID 3220617) is N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide.
What is the SMILES notation for N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide?
The canonical SMILES for N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide is O=C(Nc1ccccc1F)C(=O)Nc1cccc2ccccc12.
What is the InChIKey of N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide?
The InChIKey is FMGBITCJNHTOCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13FN2O2/c19-14-9-3-4-10-16(14)21-18(23)17(22)20-15-11-5-7-12-6-1-2-8-13(12)15/h1-11H,(H,20,22)(H,21,23).
What are the key properties of N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide?
N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide has a molecular weight of 308.31 g/mol, XLogP of 3.56, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorophenyl)-N'-naphthalen-1-yloxamide is sourced from PubChem (CID 3220617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).