C21H28N6OS — CID 3221128
1-cyclopentyl-1-[(7-ethyltetrazolo[1,5-a]quinolin-4-yl)methyl]-3-(2-methoxyethyl)thiourea (PubChem CID 3221128) has the molecular formula C21H28N6OS and a molecular weight of 412.56 g/mol. Its IUPAC name is 1-cyclopentyl-1-[(7-ethyltetrazolo[1,5-a]quinolin-4-yl)methyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-cyclopentyl-1-[(7-ethyltetrazolo[1,5-a]quinolin-4-yl)methyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 3221128 |
| Molecular Formula | C21H28N6OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-cyclopentyl-1-[(7-ethyltetrazolo[1,5-a]quinolin-4-yl)methyl]-3-(2-methoxyethyl)thiourea |
| SMILES | CCc1ccc2c(c1)cc(CN(C(=S)NCCOC)C1CCCC1)c1nnnn12 |
| InChI | InChI=1S/C21H28N6OS/c1-3-15-8-9-19-16(12-15)13-17(20-23-24-25-27(19)20)14-26(18-6-4-5-7-18)21(29)22-10-11-28-2/h8-9,12-13,18H,3-7,10-11,14H2,1-2H3,(H,22,29) |
| InChIKey | PZMDBQYJTIAXNM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|