About 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide
2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide (PubChem CID 3221165) has the molecular formula C11H13N3O3
and a molecular weight of 235.24 g/mol. Its IUPAC name is 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide.
Molecular Properties
| Compound Name | 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide |
| PubChem CID | 3221165 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide |
| SMILES | CC1(C)Oc2ccc(C(=O)NN)cc2NC1=O |
| InChI | InChI=1S/C11H13N3O3/c1-11(2)10(16)13-7-5-6(9(15)14-12)3-4-8(7)17-11/h3-5H,12H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | MQOYHPTXJMQLBG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide?
The IUPAC name of 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide (CID 3221165) is 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide.
What is the SMILES notation for 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide?
The canonical SMILES for 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide is CC1(C)Oc2ccc(C(=O)NN)cc2NC1=O.
What is the InChIKey of 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide?
The InChIKey is MQOYHPTXJMQLBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3/c1-11(2)10(16)13-7-5-6(9(15)14-12)3-4-8(7)17-11/h3-5H,12H2,1-2H3,(H,13,16)(H,14,15).
What are the key properties of 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide?
2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide has a molecular weight of 235.24 g/mol, XLogP of 0.40, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-oxo-4H-1,4-benzoxazine-6-carbohydrazide is sourced from PubChem (CID 3221165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).