C23H25N3O3S — CID 3221533
N-(2,4-dimethoxyphenyl)-3-(2-methoxyethyl)-7-methyl-4H-[1,3]thiazino[6,5-b]quinolin-2-imine (PubChem CID 3221533) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-(2-methoxyethyl)-7-methyl-4H-[1,3]thiazino[6,5-b]quinolin-2-imine.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-(2-methoxyethyl)-7-methyl-4H-[1,3]thiazino[6,5-b]quinolin-2-imine |
|---|---|
| PubChem CID | 3221533 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-(2-methoxyethyl)-7-methyl-4H-[1,3]thiazino[6,5-b]quinolin-2-imine |
| SMILES | COCCN1Cc2cc3cc(C)ccc3nc2S/C1=N\c1ccc(OC)cc1OC |
| InChI | InChI=1S/C23H25N3O3S/c1-15-5-7-19-16(11-15)12-17-14-26(9-10-27-2)23(30-22(17)24-19)25-20-8-6-18(28-3)13-21(20)29-4/h5-8,11-13H,9-10,14H2,1-4H3/b25-23- |
| InChIKey | UZSRLSPMFJBBEQ-BZZOAKBMSA-N |
| XLogP | 4.80 |
| TPSA | 56.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|