C23H31N5OS — CID 3221603
4-(3-cyano-7,8-dimethylquinolin-2-yl)-N-(3-ethoxypropyl)-1,4-diazepane-1-carbothioamide (PubChem CID 3221603) has the molecular formula C23H31N5OS and a molecular weight of 425.60 g/mol. Its IUPAC name is 4-(3-cyano-7,8-dimethylquinolin-2-yl)-N-(3-ethoxypropyl)-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-(3-cyano-7,8-dimethylquinolin-2-yl)-N-(3-ethoxypropyl)-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 3221603 |
| Molecular Formula | C23H31N5OS |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 4-(3-cyano-7,8-dimethylquinolin-2-yl)-N-(3-ethoxypropyl)-1,4-diazepane-1-carbothioamide |
| SMILES | CCOCCCNC(=S)N1CCCN(c2nc3c(C)c(C)ccc3cc2C#N)CC1 |
| InChI | InChI=1S/C23H31N5OS/c1-4-29-14-5-9-25-23(30)28-11-6-10-27(12-13-28)22-20(16-24)15-19-8-7-17(2)18(3)21(19)26-22/h7-8,15H,4-6,9-14H2,1-3H3,(H,25,30) |
| InChIKey | IQJWDDXJWWUXPJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 64.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|