About 1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea
1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea (PubChem CID 3221607) has the molecular formula C20H28N6S
and a molecular weight of 384.55 g/mol. Its IUPAC name is 1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea.
Molecular Properties
| Compound Name | 1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea |
| PubChem CID | 3221607 |
| Molecular Formula | C20H28N6S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea |
| SMILES | Cc1ccc2cc(C#N)c(NCCNC(=S)NCCCN(C)C)nc2c1C |
| InChI | InChI=1S/C20H28N6S/c1-14-6-7-16-12-17(13-21)19(25-18(16)15(14)2)22-9-10-24-20(27)23-8-5-11-26(3)4/h6-7,12H,5,8-11H2,1-4H3,(H,22,25)(H2,23,24,27) |
| InChIKey | MAIIBAMIQRMXEF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea?
The IUPAC name of 1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea (CID 3221607) is 1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea.
What is the SMILES notation for 1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea?
The canonical SMILES for 1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea is Cc1ccc2cc(C#N)c(NCCNC(=S)NCCCN(C)C)nc2c1C.
What is the InChIKey of 1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea?
The InChIKey is MAIIBAMIQRMXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N6S/c1-14-6-7-16-12-17(13-21)19(25-18(16)15(14)2)22-9-10-24-20(27)23-8-5-11-26(3)4/h6-7,12H,5,8-11H2,1-4H3,(H,22,25)(H2,23,24,27).
What are the key properties of 1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea?
1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea has a molecular weight of 384.55 g/mol, XLogP of 2.55, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(3-cyano-7,8-dimethylquinolin-2-yl)amino]ethyl]-3-[3-(dimethylamino)propyl]thiourea is sourced from PubChem (CID 3221607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).