C18H22N4O — CID 3222609
N-(3,5-dimethylphenyl)-1-pyrazin-2-ylpiperidine-4-carboxamide (PubChem CID 3222609) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-1-pyrazin-2-ylpiperidine-4-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-1-pyrazin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3222609 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-(3,5-dimethylphenyl)-1-pyrazin-2-ylpiperidine-4-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)C2CCN(c3cnccn3)CC2)c1 |
| InChI | InChI=1S/C18H22N4O/c1-13-9-14(2)11-16(10-13)21-18(23)15-3-7-22(8-4-15)17-12-19-5-6-20-17/h5-6,9-12,15H,3-4,7-8H2,1-2H3,(H,21,23) |
| InChIKey | QAPLVIGWOYYAQK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |