C15H25N5O3 — CID 3222668
N-butyl-1-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperidine-4-carboxamide (PubChem CID 3222668) has the molecular formula C15H25N5O3 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-butyl-1-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperidine-4-carboxamide.
| Compound Name | N-butyl-1-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3222668 |
| Molecular Formula | C15H25N5O3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-butyl-1-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(c2nc(OC)nc(OC)n2)CC1 |
| InChI | InChI=1S/C15H25N5O3/c1-4-5-8-16-12(21)11-6-9-20(10-7-11)13-17-14(22-2)19-15(18-13)23-3/h11H,4-10H2,1-3H3,(H,16,21) |
| InChIKey | WDEDXAMPAKTKQW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|