About 1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide
1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide (PubChem CID 3222834) has the molecular formula C18H21N3O2S
and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide |
| PubChem CID | 3222834 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide |
| SMILES | O=C(NCc1cccs1)C1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C18H21N3O2S/c22-17(19-12-16-9-5-11-24-16)14-6-4-10-21(13-14)18(23)20-15-7-2-1-3-8-15/h1-3,5,7-9,11,14H,4,6,10,12-13H2,(H,19,22)(H,20,23) |
| InChIKey | LBHGWEFJDGUUAS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide?
The IUPAC name of 1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide (CID 3222834) is 1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide.
What is the SMILES notation for 1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide?
The canonical SMILES for 1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide is O=C(NCc1cccs1)C1CCCN(C(=O)Nc2ccccc2)C1.
What is the InChIKey of 1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide?
The InChIKey is LBHGWEFJDGUUAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O2S/c22-17(19-12-16-9-5-11-24-16)14-6-4-10-21(13-14)18(23)20-15-7-2-1-3-8-15/h1-3,5,7-9,11,14H,4,6,10,12-13H2,(H,19,22)(H,20,23).
What are the key properties of 1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide?
1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide has a molecular weight of 343.45 g/mol, XLogP of 3.31, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-phenyl-3-N-(thiophen-2-ylmethyl)piperidine-1,3-dicarboxamide is sourced from PubChem (CID 3222834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).