C19H23N3O3 — CID 3222914
4-(cyanomethyl)-N-cyclohexyl-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxamide (PubChem CID 3222914) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-(cyanomethyl)-N-cyclohexyl-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxamide.
| Compound Name | 4-(cyanomethyl)-N-cyclohexyl-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 3222914 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 4-(cyanomethyl)-N-cyclohexyl-2,2-dimethyl-3-oxo-1,4-benzoxazine-6-carboxamide |
| SMILES | CC1(C)Oc2ccc(C(=O)NC3CCCCC3)cc2N(CC#N)C1=O |
| InChI | InChI=1S/C19H23N3O3/c1-19(2)18(24)22(11-10-20)15-12-13(8-9-16(15)25-19)17(23)21-14-6-4-3-5-7-14/h8-9,12,14H,3-7,11H2,1-2H3,(H,21,23) |
| InChIKey | QQEJBIYCCCLUQB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|