C18H23N3O3 — CID 3223070
4-(cyanomethyl)-2,2-dimethyl-N-(2-methylbutan-2-yl)-3-oxo-1,4-benzoxazine-6-carboxamide (PubChem CID 3223070) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-(cyanomethyl)-2,2-dimethyl-N-(2-methylbutan-2-yl)-3-oxo-1,4-benzoxazine-6-carboxamide.
| Compound Name | 4-(cyanomethyl)-2,2-dimethyl-N-(2-methylbutan-2-yl)-3-oxo-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 3223070 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 4-(cyanomethyl)-2,2-dimethyl-N-(2-methylbutan-2-yl)-3-oxo-1,4-benzoxazine-6-carboxamide |
| SMILES | CCC(C)(C)NC(=O)c1ccc2c(c1)N(CC#N)C(=O)C(C)(C)O2 |
| InChI | InChI=1S/C18H23N3O3/c1-6-17(2,3)20-15(22)12-7-8-14-13(11-12)21(10-9-19)16(23)18(4,5)24-14/h7-8,11H,6,10H2,1-5H3,(H,20,22) |
| InChIKey | ONHLCADVFNXWEX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|