C19H22ClN5O2 — CID 3223274
N'-(4-chlorobenzoyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbohydrazide (PubChem CID 3223274) has the molecular formula C19H22ClN5O2 and a molecular weight of 387.87 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbohydrazide.
| Compound Name | N'-(4-chlorobenzoyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 3223274 |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N'-(4-chlorobenzoyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carbohydrazide |
| SMILES | Cc1cc(C)nc(N2CCC(C(=O)NNC(=O)c3ccc(Cl)cc3)CC2)n1 |
| InChI | InChI=1S/C19H22ClN5O2/c1-12-11-13(2)22-19(21-12)25-9-7-15(8-10-25)18(27)24-23-17(26)14-3-5-16(20)6-4-14/h3-6,11,15H,7-10H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | YDEVJVSYUOVLPZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|