About N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide
N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide (PubChem CID 3223312) has the molecular formula C16H26N4O
and a molecular weight of 290.41 g/mol. Its IUPAC name is N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide |
| PubChem CID | 3223312 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(c2nc(C)cc(C)n2)CC1 |
| InChI | InChI=1S/C16H26N4O/c1-4-5-8-17-15(21)14-6-9-20(10-7-14)16-18-12(2)11-13(3)19-16/h11,14H,4-10H2,1-3H3,(H,17,21) |
| InChIKey | ZNIATXBCTQIYMM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide?
The IUPAC name of N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide (CID 3223312) is N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide.
What is the SMILES notation for N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide?
The canonical SMILES for N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide is CCCCNC(=O)C1CCN(c2nc(C)cc(C)n2)CC1.
What is the InChIKey of N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide?
The InChIKey is ZNIATXBCTQIYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O/c1-4-5-8-17-15(21)14-6-9-20(10-7-14)16-18-12(2)11-13(3)19-16/h11,14H,4-10H2,1-3H3,(H,17,21).
What are the key properties of N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide?
N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide has a molecular weight of 290.41 g/mol, XLogP of 2.23, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-1-(4,6-dimethylpyrimidin-2-yl)piperidine-4-carboxamide is sourced from PubChem (CID 3223312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).