About 1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide
1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 3223324) has the molecular formula C20H26N4O
and a molecular weight of 338.46 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide |
| PubChem CID | 3223324 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C2CCN(c3nc(C)cc(C)n3)CC2)cc1 |
| InChI | InChI=1S/C20H26N4O/c1-14-4-6-17(7-5-14)13-21-19(25)18-8-10-24(11-9-18)20-22-15(2)12-16(3)23-20/h4-7,12,18H,8-11,13H2,1-3H3,(H,21,25) |
| InChIKey | ZCVSUZMOUXSQNG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide?
The IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide (CID 3223324) is 1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide?
The canonical SMILES for 1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide is Cc1ccc(CNC(=O)C2CCN(c3nc(C)cc(C)n3)CC2)cc1.
What is the InChIKey of 1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide?
The InChIKey is ZCVSUZMOUXSQNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O/c1-14-4-6-17(7-5-14)13-21-19(25)18-8-10-24(11-9-18)20-22-15(2)12-16(3)23-20/h4-7,12,18H,8-11,13H2,1-3H3,(H,21,25).
What are the key properties of 1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide?
1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide has a molecular weight of 338.46 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide is sourced from PubChem (CID 3223324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).