About 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide
4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide (PubChem CID 3223617) has the molecular formula C18H23FN4OS2
and a molecular weight of 394.54 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide.
Molecular Properties
| Compound Name | 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide |
| PubChem CID | 3223617 |
| Molecular Formula | C18H23FN4OS2 |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide |
| SMILES | COCCCNC(=S)N1CCN(c2nc(-c3ccc(F)cc3)cs2)CC1 |
| InChI | InChI=1S/C18H23FN4OS2/c1-24-12-2-7-20-17(25)22-8-10-23(11-9-22)18-21-16(13-26-18)14-3-5-15(19)6-4-14/h3-6,13H,2,7-12H2,1H3,(H,20,25) |
| InChIKey | USXULQFZBJCRHV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide?
The IUPAC name of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide (CID 3223617) is 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide.
What is the SMILES notation for 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide?
The canonical SMILES for 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide is COCCCNC(=S)N1CCN(c2nc(-c3ccc(F)cc3)cs2)CC1.
What is the InChIKey of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide?
The InChIKey is USXULQFZBJCRHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23FN4OS2/c1-24-12-2-7-20-17(25)22-8-10-23(11-9-22)18-21-16(13-26-18)14-3-5-15(19)6-4-14/h3-6,13H,2,7-12H2,1H3,(H,20,25).
What are the key properties of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide?
4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide has a molecular weight of 394.54 g/mol, XLogP of 2.98, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-N-(3-methoxypropyl)piperazine-1-carbothioamide is sourced from PubChem (CID 3223617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).