About 2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate
2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate (PubChem CID 3224085) has the molecular formula C22H21N3O2
and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate.
Molecular Properties
| Compound Name | 2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate |
| PubChem CID | 3224085 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate |
| SMILES | Cc1cc(C)c2cc(C#N)c(NCCOC(=O)c3ccccc3C)nc2c1 |
| InChI | InChI=1S/C22H21N3O2/c1-14-10-16(3)19-12-17(13-23)21(25-20(19)11-14)24-8-9-27-22(26)18-7-5-4-6-15(18)2/h4-7,10-12H,8-9H2,1-3H3,(H,24,25) |
| InChIKey | KQPIFLSXABRUQY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate?
The IUPAC name of 2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate (CID 3224085) is 2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate.
What is the SMILES notation for 2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate?
The canonical SMILES for 2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate is Cc1cc(C)c2cc(C#N)c(NCCOC(=O)c3ccccc3C)nc2c1.
What is the InChIKey of 2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate?
The InChIKey is KQPIFLSXABRUQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O2/c1-14-10-16(3)19-12-17(13-23)21(25-20(19)11-14)24-8-9-27-22(26)18-7-5-4-6-15(18)2/h4-7,10-12H,8-9H2,1-3H3,(H,24,25).
What are the key properties of 2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate?
2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate has a molecular weight of 359.43 g/mol, XLogP of 4.30, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl 2-methylbenzoate is sourced from PubChem (CID 3224085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).