About N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide
N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide (PubChem CID 3224223) has the molecular formula C18H21ClN4O
and a molecular weight of 344.85 g/mol. Its IUPAC name is N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide |
| PubChem CID | 3224223 |
| Molecular Formula | C18H21ClN4O |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C)nc(N2CCCC(C(=O)Nc3cccc(Cl)c3)C2)n1 |
| InChI | InChI=1S/C18H21ClN4O/c1-12-9-13(2)21-18(20-12)23-8-4-5-14(11-23)17(24)22-16-7-3-6-15(19)10-16/h3,6-7,9-10,14H,4-5,8,11H2,1-2H3,(H,22,24) |
| InChIKey | NFFDKGBHPMHXAA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide?
The IUPAC name of N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide (CID 3224223) is N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide.
What is the SMILES notation for N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide?
The canonical SMILES for N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide is Cc1cc(C)nc(N2CCCC(C(=O)Nc3cccc(Cl)c3)C2)n1.
What is the InChIKey of N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide?
The InChIKey is NFFDKGBHPMHXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21ClN4O/c1-12-9-13(2)21-18(20-12)23-8-4-5-14(11-23)17(24)22-16-7-3-6-15(19)10-16/h3,6-7,9-10,14H,4-5,8,11H2,1-2H3,(H,22,24).
What are the key properties of N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide?
N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide has a molecular weight of 344.85 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide is sourced from PubChem (CID 3224223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).