C22H32N4O — CID 3224246
N-(1-adamantyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide (PubChem CID 3224246) has the molecular formula C22H32N4O and a molecular weight of 368.53 g/mol. Its IUPAC name is N-(1-adamantyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide.
| Compound Name | N-(1-adamantyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 3224246 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | N-(1-adamantyl)-1-(4,6-dimethylpyrimidin-2-yl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C)nc(N2CCCC(C(=O)NC34CC5CC(CC(C5)C3)C4)C2)n1 |
| InChI | InChI=1S/C22H32N4O/c1-14-6-15(2)24-21(23-14)26-5-3-4-19(13-26)20(27)25-22-10-16-7-17(11-22)9-18(8-16)12-22/h6,16-19H,3-5,7-13H2,1-2H3,(H,25,27) |
| InChIKey | FTZSDKRFGZKTBI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |