C21H19N7O2 — CID 3224444
2-[3-(2-methylphenyl)-6-oxopyridazin-1-yl]-N-[3-methyl-4-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 3224444) has the molecular formula C21H19N7O2 and a molecular weight of 401.43 g/mol. Its IUPAC name is 2-[3-(2-methylphenyl)-6-oxopyridazin-1-yl]-N-[3-methyl-4-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | 2-[3-(2-methylphenyl)-6-oxopyridazin-1-yl]-N-[3-methyl-4-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 3224444 |
| Molecular Formula | C21H19N7O2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-[3-(2-methylphenyl)-6-oxopyridazin-1-yl]-N-[3-methyl-4-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | Cc1ccccc1-c1ccc(=O)n(CC(=O)Nc2ccc(-n3cnnn3)c(C)c2)n1 |
| InChI | InChI=1S/C21H19N7O2/c1-14-5-3-4-6-17(14)18-8-10-21(30)27(24-18)12-20(29)23-16-7-9-19(15(2)11-16)28-13-22-25-26-28/h3-11,13H,12H2,1-2H3,(H,23,29) |
| InChIKey | IYIJZSGUABRSFG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |