C17H17F2NOS — CID 3224911
N-cyclopentyl-2,6-difluoro-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 3224911) has the molecular formula C17H17F2NOS and a molecular weight of 321.39 g/mol. Its IUPAC name is N-cyclopentyl-2,6-difluoro-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | N-cyclopentyl-2,6-difluoro-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3224911 |
| Molecular Formula | C17H17F2NOS |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-cyclopentyl-2,6-difluoro-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(c1c(F)cccc1F)N(Cc1cccs1)C1CCCC1 |
| InChI | InChI=1S/C17H17F2NOS/c18-14-8-3-9-15(19)16(14)17(21)20(12-5-1-2-6-12)11-13-7-4-10-22-13/h3-4,7-10,12H,1-2,5-6,11H2 |
| InChIKey | IVEZSYFGXQCLCJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |