C14H11ClN2OS — CID 3225249
N-(2-chlorophenyl)-4-methylthieno[3,2-b]pyrrole-5-carboxamide (PubChem CID 3225249) has the molecular formula C14H11ClN2OS and a molecular weight of 290.78 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-methylthieno[3,2-b]pyrrole-5-carboxamide.
| Compound Name | N-(2-chlorophenyl)-4-methylthieno[3,2-b]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 3225249 |
| Molecular Formula | C14H11ClN2OS |
| Molecular Weight | 290.78 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | N-(2-chlorophenyl)-4-methylthieno[3,2-b]pyrrole-5-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccccc2Cl)cc2sccc21 |
| InChI | InChI=1S/C14H11ClN2OS/c1-17-11-6-7-19-13(11)8-12(17)14(18)16-10-5-3-2-4-9(10)15/h2-8H,1H3,(H,16,18) |
| InChIKey | XCRMEQGCLPAGKT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.78 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |