C24H27N3O3S — CID 3226640
N-[2-(2-methoxyethylamino)-2-oxo-1-phenylethyl]-2,4-dimethyl-N-(3-methylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 3226640) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[2-(2-methoxyethylamino)-2-oxo-1-phenylethyl]-2,4-dimethyl-N-(3-methylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-(2-methoxyethylamino)-2-oxo-1-phenylethyl]-2,4-dimethyl-N-(3-methylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 3226640 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-[2-(2-methoxyethylamino)-2-oxo-1-phenylethyl]-2,4-dimethyl-N-(3-methylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | COCCNC(=O)C(c1ccccc1)N(C(=O)c1sc(C)nc1C)c1cccc(C)c1 |
| InChI | InChI=1S/C24H27N3O3S/c1-16-9-8-12-20(15-16)27(24(29)22-17(2)26-18(3)31-22)21(19-10-6-5-7-11-19)23(28)25-13-14-30-4/h5-12,15,21H,13-14H2,1-4H3,(H,25,28) |
| InChIKey | PWTWAXKQPVGZHC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|