About 2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide
2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide (PubChem CID 3227666) has the molecular formula C19H22N2O2
and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide.
Molecular Properties
| Compound Name | 2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide |
| PubChem CID | 3227666 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide |
| SMILES | CCC1CN(C(=O)Nc2cccc(C)c2)c2cc(C)ccc2O1 |
| InChI | InChI=1S/C19H22N2O2/c1-4-16-12-21(17-11-14(3)8-9-18(17)23-16)19(22)20-15-7-5-6-13(2)10-15/h5-11,16H,4,12H2,1-3H3,(H,20,22) |
| InChIKey | LQEHRDHPSSJMCY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide?
The IUPAC name of 2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide (CID 3227666) is 2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide.
What is the SMILES notation for 2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide?
The canonical SMILES for 2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide is CCC1CN(C(=O)Nc2cccc(C)c2)c2cc(C)ccc2O1.
What is the InChIKey of 2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide?
The InChIKey is LQEHRDHPSSJMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2/c1-4-16-12-21(17-11-14(3)8-9-18(17)23-16)19(22)20-15-7-5-6-13(2)10-15/h5-11,16H,4,12H2,1-3H3,(H,20,22).
What are the key properties of 2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide?
2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide has a molecular weight of 310.40 g/mol, XLogP of 4.51, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-methyl-N-(3-methylphenyl)-2,3-dihydro-1,4-benzoxazine-4-carboxamide is sourced from PubChem (CID 3227666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).