C17H18N4O2S — CID 3227761
2-[[5-(1H-benzimidazol-2-yl)-2-pyridinyl]sulfanyl]-N-(2-methoxyethyl)acetamide (PubChem CID 3227761) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[[5-(1H-benzimidazol-2-yl)-2-pyridinyl]sulfanyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[5-(1H-benzimidazol-2-yl)-2-pyridinyl]sulfanyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 3227761 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[[5-(1H-benzimidazol-2-yl)-2-pyridinyl]sulfanyl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CSc1ccc(-c2nc3ccccc3[nH]2)cn1 |
| InChI | InChI=1S/C17H18N4O2S/c1-23-9-8-18-15(22)11-24-16-7-6-12(10-19-16)17-20-13-4-2-3-5-14(13)21-17/h2-7,10H,8-9,11H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | SQBYOKKXELTDOM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|