About 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile (PubChem CID 3228153) has the molecular formula C6H8N4S
and a molecular weight of 168.22 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile |
| PubChem CID | 3228153 |
| Molecular Formula | C6H8N4S |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile |
| SMILES | Cc1nnc(SCC#N)n1C |
| InChI | InChI=1S/C6H8N4S/c1-5-8-9-6(10(5)2)11-4-3-7/h4H2,1-2H3 |
| InChIKey | IPQBAYISRVLBNK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile?
The IUPAC name of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile (CID 3228153) is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile.
What is the SMILES notation for 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile?
The canonical SMILES for 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile is Cc1nnc(SCC#N)n1C.
What is the InChIKey of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile?
The InChIKey is IPQBAYISRVLBNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4S/c1-5-8-9-6(10(5)2)11-4-3-7/h4H2,1-2H3.
What are the key properties of 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile?
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile has a molecular weight of 168.22 g/mol, XLogP of 0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]acetonitrile is sourced from PubChem (CID 3228153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).