About N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine
N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 3228495) has the molecular formula C11H14N2OS
and a molecular weight of 222.31 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
Molecular Properties
| Compound Name | N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| PubChem CID | 3228495 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | COc1cccc(NC2=NCCCS2)c1 |
| InChI | InChI=1S/C11H14N2OS/c1-14-10-5-2-4-9(8-10)13-11-12-6-3-7-15-11/h2,4-5,8H,3,6-7H2,1H3,(H,12,13) |
| InChIKey | TVPCYEHKVSYVIZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The IUPAC name of N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (CID 3228495) is N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
What is the SMILES notation for N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The canonical SMILES for N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine is COc1cccc(NC2=NCCCS2)c1.
What is the InChIKey of N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The InChIKey is TVPCYEHKVSYVIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS/c1-14-10-5-2-4-9(8-10)13-11-12-6-3-7-15-11/h2,4-5,8H,3,6-7H2,1H3,(H,12,13).
What are the key properties of N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine has a molecular weight of 222.31 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine is sourced from PubChem (CID 3228495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).