About 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide
2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide (PubChem CID 3228990) has the molecular formula C13H15ClFN5OS
and a molecular weight of 343.82 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide |
| PubChem CID | 3228990 |
| Molecular Formula | C13H15ClFN5OS |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1nnnn1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClFN5OS/c1-3-19(4-2)12(21)8-22-13-16-17-18-20(13)9-5-6-11(15)10(14)7-9/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | UURQACZPHCHADK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide?
The IUPAC name of 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide (CID 3228990) is 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide.
What is the SMILES notation for 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide?
The canonical SMILES for 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide is CCN(CC)C(=O)CSc1nnnn1-c1ccc(F)c(Cl)c1.
What is the InChIKey of 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide?
The InChIKey is UURQACZPHCHADK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClFN5OS/c1-3-19(4-2)12(21)8-22-13-16-17-18-20(13)9-5-6-11(15)10(14)7-9/h5-7H,3-4,8H2,1-2H3.
What are the key properties of 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide?
2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide has a molecular weight of 343.82 g/mol, XLogP of 2.42, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3-chloro-4-fluorophenyl)tetrazol-5-yl]sulfanyl-N,N-diethylacetamide is sourced from PubChem (CID 3228990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).