C21H23FN6O3 — CID 3229068
N'-[2-[4-(5-fluorobenzotriazol-1-yl)piperidin-1-yl]acetyl]-4-methoxybenzohydrazide (PubChem CID 3229068) has the molecular formula C21H23FN6O3 and a molecular weight of 426.45 g/mol. Its IUPAC name is N'-[2-[4-(5-fluorobenzotriazol-1-yl)piperidin-1-yl]acetyl]-4-methoxybenzohydrazide.
| Compound Name | N'-[2-[4-(5-fluorobenzotriazol-1-yl)piperidin-1-yl]acetyl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 3229068 |
| Molecular Formula | C21H23FN6O3 |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N'-[2-[4-(5-fluorobenzotriazol-1-yl)piperidin-1-yl]acetyl]-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CN2CCC(n3nnc4cc(F)ccc43)CC2)cc1 |
| InChI | InChI=1S/C21H23FN6O3/c1-31-17-5-2-14(3-6-17)21(30)25-24-20(29)13-27-10-8-16(9-11-27)28-19-7-4-15(22)12-18(19)23-26-28/h2-7,12,16H,8-11,13H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | AZZGFNDBOPOTGR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|