C20H24FN5 — CID 3229948
N-[11-(3-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 3229948) has the molecular formula C20H24FN5 and a molecular weight of 353.45 g/mol. Its IUPAC name is N-[11-(3-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[11-(3-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 3229948 |
| Molecular Formula | C20H24FN5 |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-[11-(3-fluorophenyl)-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1c2c(nc3cc(-c4cccc(F)c4)nn13)CCC2 |
| InChI | InChI=1S/C20H24FN5/c1-25(2)11-5-10-22-20-16-8-4-9-17(16)23-19-13-18(24-26(19)20)14-6-3-7-15(21)12-14/h3,6-7,12-13,22H,4-5,8-11H2,1-2H3 |
| InChIKey | SKSVYFLNGVJEEB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|