C16H21N5S — CID 3229956
N',N'-dimethyl-N-(5-methyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)propane-1,3-diamine (PubChem CID 3229956) has the molecular formula C16H21N5S and a molecular weight of 315.45 g/mol. Its IUPAC name is N',N'-dimethyl-N-(5-methyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(5-methyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 3229956 |
| Molecular Formula | C16H21N5S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N',N'-dimethyl-N-(5-methyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)propane-1,3-diamine |
| SMILES | Cc1cc(NCCCN(C)C)n2nc(-c3cccs3)cc2n1 |
| InChI | InChI=1S/C16H21N5S/c1-12-10-15(17-7-5-8-20(2)3)21-16(18-12)11-13(19-21)14-6-4-9-22-14/h4,6,9-11,17H,5,7-8H2,1-3H3 |
| InChIKey | QRSJZUGPUITFRC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|