C18H25N5S — CID 3229957
N',N'-diethyl-N-(5-methyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)propane-1,3-diamine (PubChem CID 3229957) has the molecular formula C18H25N5S and a molecular weight of 343.50 g/mol. Its IUPAC name is N',N'-diethyl-N-(5-methyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-(5-methyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 3229957 |
| Molecular Formula | C18H25N5S |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N',N'-diethyl-N-(5-methyl-2-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-7-yl)propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1cc(C)nc2cc(-c3cccs3)nn12 |
| InChI | InChI=1S/C18H25N5S/c1-4-22(5-2)10-7-9-19-17-12-14(3)20-18-13-15(21-23(17)18)16-8-6-11-24-16/h6,8,11-13,19H,4-5,7,9-10H2,1-3H3 |
| InChIKey | VWWIRGYCRUALOU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|