C24H30FN5O — CID 3230152
9-[4-(2-ethoxyethyl)piperazin-1-yl]-2-(3-fluorophenyl)-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline (PubChem CID 3230152) has the molecular formula C24H30FN5O and a molecular weight of 423.54 g/mol. Its IUPAC name is 9-[4-(2-ethoxyethyl)piperazin-1-yl]-2-(3-fluorophenyl)-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline.
| Compound Name | 9-[4-(2-ethoxyethyl)piperazin-1-yl]-2-(3-fluorophenyl)-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline |
|---|---|
| PubChem CID | 3230152 |
| Molecular Formula | C24H30FN5O |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 9-[4-(2-ethoxyethyl)piperazin-1-yl]-2-(3-fluorophenyl)-5,6,7,8-tetrahydropyrazolo[5,1-b]quinazoline |
| SMILES | CCOCCN1CCN(c2c3c(nc4cc(-c5cccc(F)c5)nn24)CCCC3)CC1 |
| InChI | InChI=1S/C24H30FN5O/c1-2-31-15-14-28-10-12-29(13-11-28)24-20-8-3-4-9-21(20)26-23-17-22(27-30(23)24)18-6-5-7-19(25)16-18/h5-7,16-17H,2-4,8-15H2,1H3 |
| InChIKey | PYYCXABSBXBBQD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|