C18H25N3O2 — CID 3230191
2-N-cyclopentyl-1-N-(3-methylphenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 3230191) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-N-cyclopentyl-1-N-(3-methylphenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 2-N-cyclopentyl-1-N-(3-methylphenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 3230191 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 2-N-cyclopentyl-1-N-(3-methylphenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)N2CCCC2C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C18H25N3O2/c1-13-6-4-9-15(12-13)20-18(23)21-11-5-10-16(21)17(22)19-14-7-2-3-8-14/h4,6,9,12,14,16H,2-3,5,7-8,10-11H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | BDZDSDRDHZHQGU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |