About 2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide
2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 3230358) has the molecular formula C20H20FN5O5
and a molecular weight of 429.41 g/mol. Its IUPAC name is 2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide |
| PubChem CID | 3230358 |
| Molecular Formula | C20H20FN5O5 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C2CCCN2C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H20FN5O5/c1-12(27)22-13-4-6-14(7-5-13)23-19(28)17-3-2-10-25(17)20(29)24-15-8-9-16(21)18(11-15)26(30)31/h4-9,11,17H,2-3,10H2,1H3,(H,22,27)(H,23,28)(H,24,29) |
| InChIKey | UKFNLQKVAPSNCR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide?
The IUPAC name of 2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide (CID 3230358) is 2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide.
What is the SMILES notation for 2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide?
The canonical SMILES for 2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide is CC(=O)Nc1ccc(NC(=O)C2CCCN2C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cc1.
What is the InChIKey of 2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide?
The InChIKey is UKFNLQKVAPSNCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FN5O5/c1-12(27)22-13-4-6-14(7-5-13)23-19(28)17-3-2-10-25(17)20(29)24-15-8-9-16(21)18(11-15)26(30)31/h4-9,11,17H,2-3,10H2,1H3,(H,22,27)(H,23,28)(H,24,29).
What are the key properties of 2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide?
2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide has a molecular weight of 429.41 g/mol, XLogP of 3.33, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide is sourced from PubChem (CID 3230358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).