C15H16N2O6 — CID 3230418
4-(3,4,5-trimethoxyphenyl)-1,3,4,7-tetrahydrofuro[3,4-d]pyrimidine-2,5-dione (PubChem CID 3230418) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is 4-(3,4,5-trimethoxyphenyl)-1,3,4,7-tetrahydrofuro[3,4-d]pyrimidine-2,5-dione.
| Compound Name | 4-(3,4,5-trimethoxyphenyl)-1,3,4,7-tetrahydrofuro[3,4-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 3230418 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 4-(3,4,5-trimethoxyphenyl)-1,3,4,7-tetrahydrofuro[3,4-d]pyrimidine-2,5-dione |
| SMILES | COc1cc(C2NC(=O)NC3=C2C(=O)OC3)cc(OC)c1OC |
| InChI | InChI=1S/C15H16N2O6/c1-20-9-4-7(5-10(21-2)13(9)22-3)12-11-8(6-23-14(11)18)16-15(19)17-12/h4-5,12H,6H2,1-3H3,(H2,16,17,19) |
| InChIKey | UZCGXJVYCJBSPO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |